C21H23N3O6 — CID 59968348
(1S,2R,6S,8S)-4-ethyl-8,10-dimethyl-12-[2-(4-nitrophenyl)acetyl]-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-ene-3,5-dione (PubChem CID 59968348) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is (1S,2R,6S,8S)-4-ethyl-8,10-dimethyl-12-[2-(4-nitrophenyl)acetyl]-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-ene-3,5-dione.
| Compound Name | (1S,2R,6S,8S)-4-ethyl-8,10-dimethyl-12-[2-(4-nitrophenyl)acetyl]-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-ene-3,5-dione |
|---|---|
| PubChem CID | 59968348 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (1S,2R,6S,8S)-4-ethyl-8,10-dimethyl-12-[2-(4-nitrophenyl)acetyl]-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-ene-3,5-dione |
| SMILES | CCN1C(=O)[C@H]2[C@H](O[C@@]3(C)C=C(C)CN(C(=O)Cc4ccc([N+](=O)[O-])cc4)[C@@H]23)C1=O |
| InChI | InChI=1S/C21H23N3O6/c1-4-22-19(26)16-17(20(22)27)30-21(3)10-12(2)11-23(18(16)21)15(25)9-13-5-7-14(8-6-13)24(28)29/h5-8,10,16-18H,4,9,11H2,1-3H3/t16-,17-,18-,21-/m0/s1 |
| InChIKey | SQUBFLJENZQMQK-NTLWEQJWSA-N |
| XLogP | 1.46 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|