C18H22N2O3 — CID 59968357
(1S,2R,6S,8S,10R)-4-benzyl-8,10-dimethyl-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione (PubChem CID 59968357) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1S,2R,6S,8S,10R)-4-benzyl-8,10-dimethyl-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione.
| Compound Name | (1S,2R,6S,8S,10R)-4-benzyl-8,10-dimethyl-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione |
|---|---|
| PubChem CID | 59968357 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (1S,2R,6S,8S,10R)-4-benzyl-8,10-dimethyl-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione |
| SMILES | C[C@H]1CN[C@H]2[C@H]3C(=O)N(Cc4ccccc4)C(=O)[C@H]3O[C@@]2(C)C1 |
| InChI | InChI=1S/C18H22N2O3/c1-11-8-18(2)15(19-9-11)13-14(23-18)17(22)20(16(13)21)10-12-6-4-3-5-7-12/h3-7,11,13-15,19H,8-10H2,1-2H3/t11-,13+,14+,15+,18+/m1/s1 |
| InChIKey | MBPCMOHEJIWALY-ACDVHTNFSA-N |
| XLogP | 1.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|