C34H50O9 — CID 59968475
[(E,3S)-3-ethyl-8-(methoxymethoxy)-7-methyl-6-oxo-9-[(4E,6E,12E,14E)-3,10,11-trimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-4,6,12,14-tetraen-2-yl]dec-4-en-2-yl] acetate (PubChem CID 59968475) has the molecular formula C34H50O9 and a molecular weight of 602.77 g/mol. Its IUPAC name is [(E,3S)-3-ethyl-8-(methoxymethoxy)-7-methyl-6-oxo-9-[(4E,6E,12E,14E)-3,10,11-trimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-4,6,12,14-tetraen-2-yl]dec-4-en-2-yl] acetate.
| Compound Name | [(E,3S)-3-ethyl-8-(methoxymethoxy)-7-methyl-6-oxo-9-[(4E,6E,12E,14E)-3,10,11-trimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-4,6,12,14-tetraen-2-yl]dec-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 59968475 |
| Molecular Formula | C34H50O9 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | [(E,3S)-3-ethyl-8-(methoxymethoxy)-7-methyl-6-oxo-9-[(4E,6E,12E,14E)-3,10,11-trimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-4,6,12,14-tetraen-2-yl]dec-4-en-2-yl] acetate |
| SMILES | CC[C@@H](/C=C/C(=O)C(C)C(OCOC)C(C)C1OC(=O)/C=C/C=C/C(C)C(C)OC(=O)/C=C/C=C/C1C)C(C)OC(C)=O |
| InChI | InChI=1S/C34H50O9/c1-10-29(27(7)41-28(8)35)19-20-30(36)24(4)34(40-21-39-9)25(5)33-23(3)16-12-14-17-31(37)42-26(6)22(2)15-11-13-18-32(38)43-33/h11-20,22-27,29,33-34H,10,21H2,1-9H3/b15-11+,16-12+,17-14+,18-13+,20-19+/t22?,23?,24?,25?,26?,27?,29-,33?,34?/m0/s1 |
| InChIKey | SLNXMCAUCMTCRJ-MSDGNUJJSA-N |
| XLogP | 5.70 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|