C32H48O7 — CID 59968481
(3E,5E,11E,13E)-8-[(E)-8-ethyl-3,9-dimethoxy-4-methyl-5-oxodec-6-en-2-yl]-7,15,16-trimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione (PubChem CID 59968481) has the molecular formula C32H48O7 and a molecular weight of 544.73 g/mol. Its IUPAC name is (3E,5E,11E,13E)-8-[(E)-8-ethyl-3,9-dimethoxy-4-methyl-5-oxodec-6-en-2-yl]-7,15,16-trimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione.
| Compound Name | (3E,5E,11E,13E)-8-[(E)-8-ethyl-3,9-dimethoxy-4-methyl-5-oxodec-6-en-2-yl]-7,15,16-trimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
|---|---|
| PubChem CID | 59968481 |
| Molecular Formula | C32H48O7 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | (3E,5E,11E,13E)-8-[(E)-8-ethyl-3,9-dimethoxy-4-methyl-5-oxodec-6-en-2-yl]-7,15,16-trimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
| SMILES | CCC(/C=C/C(=O)C(C)C(OC)C(C)C1OC(=O)/C=C/C=C/C(C)C(C)OC(=O)/C=C/C=C/C1C)C(C)OC |
| InChI | InChI=1S/C32H48O7/c1-10-27(26(7)36-8)19-20-28(33)23(4)32(37-9)24(5)31-22(3)16-12-14-17-29(34)38-25(6)21(2)15-11-13-18-30(35)39-31/h11-27,31-32H,10H2,1-9H3/b15-11+,16-12+,17-14+,18-13+,20-19+ |
| InChIKey | XMBGMNHFPLQLCE-JNAOFUJGSA-N |
| XLogP | 5.81 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|