About (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate
(2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 59968534) has the molecular formula C12H13NO4
and a molecular weight of 235.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 59968534 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)C1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H13NO4/c14-10-3-4-11(15)13(10)17-12(16)9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2/t7-,8+,9?/m0/s1 |
| InChIKey | XMCIHUNYRDAXMZ-ZQTLJVIJSA-N |
| XLogP | 0.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 59968534) is (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate is O=C(ON1C(=O)CCC1=O)C1C[C@H]2C=C[C@@H]1C2.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is XMCIHUNYRDAXMZ-ZQTLJVIJSA-N. The full InChI is InChI=1S/C12H13NO4/c14-10-3-4-11(15)13(10)17-12(16)9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2/t7-,8+,9?/m0/s1.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate?
(2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 235.24 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) (1S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 59968534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).