About CID 59968605
CID 59968605 (PubChem CID 59968605) has the molecular formula C5H9BO
and a molecular weight of 95.94 g/mol.
Molecular Properties
| Compound Name | CID 59968605 |
| PubChem CID | 59968605 |
| Molecular Formula | C5H9BO |
| Molecular Weight | 95.94 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CC[C@@H](C)O1 |
| InChI | InChI=1S/C5H9BO/c1-4-2-3-5(6)7-4/h4-5H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | TXJIPJZKRZIKGQ-RFZPGFLSSA-N |
| XLogP | 0.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.94 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59968605 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59968605?
The IUPAC name of CID 59968605 (CID 59968605) is not available.
What is the SMILES notation for CID 59968605?
The canonical SMILES for CID 59968605 is [B][C@H]1CC[C@@H](C)O1.
What is the InChIKey of CID 59968605?
The InChIKey is TXJIPJZKRZIKGQ-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H9BO/c1-4-2-3-5(6)7-4/h4-5H,2-3H2,1H3/t4-,5-/m1/s1.
What are the key properties of CID 59968605?
CID 59968605 has a molecular weight of 95.94 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59968605 is sourced from PubChem (CID 59968605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).