C9H12O5 — CID 59968724
(3R,3aR,6R,6aR)-3,6-dimethoxy-2-methylidene-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5-one (PubChem CID 59968724) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-3,6-dimethoxy-2-methylidene-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5-one.
| Compound Name | (3R,3aR,6R,6aR)-3,6-dimethoxy-2-methylidene-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 59968724 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (3R,3aR,6R,6aR)-3,6-dimethoxy-2-methylidene-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5-one |
| SMILES | C=C1O[C@@H]2[C@@H](OC(=O)[C@@H]2OC)[C@H]1OC |
| InChI | InChI=1S/C9H12O5/c1-4-5(11-2)6-7(13-4)8(12-3)9(10)14-6/h5-8H,1H2,2-3H3/t5-,6-,7+,8+/m0/s1 |
| InChIKey | RSUFYXXAZWUNSV-RULNZFCNSA-N |
| XLogP | -0.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |