About 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate
1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate (PubChem CID 59968778) has the molecular formula C10H20FNO3P
and a molecular weight of 252.25 g/mol.
Analyze 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate?
The IUPAC name of 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate (CID 59968778) is not available.
What is the SMILES notation for 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate?
The canonical SMILES for 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate is CC1(C)CC(OP(C)(=O)F)CC(C)(C)N1[O].
What is the InChIKey of 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate?
The InChIKey is FQSRTNDDKAOMTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20FNO3P/c1-9(2)6-8(15-16(5,11)14)7-10(3,4)12(9)13/h8H,6-7H2,1-5H3.
What are the key properties of 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate?
1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate has a molecular weight of 252.25 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Oxyl-2,2,6,6-tetramethyl-4-piperidinyl methylphosphonofluoridate is sourced from PubChem (CID 59968778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).