About N-phenylmethanimine;yttrium
N-phenylmethanimine;yttrium (PubChem CID 59968996) has the molecular formula C7H5NY-2
and a molecular weight of 192.03 g/mol. Its IUPAC name is N-phenylmethanimine;yttrium.
Molecular Properties
| Compound Name | N-phenylmethanimine;yttrium |
| PubChem CID | 59968996 |
| Molecular Formula | C7H5NY-2 |
| Molecular Weight | 192.03 g/mol |
| Exact Mass | 191.95 |
| IUPAC Name | N-phenylmethanimine;yttrium |
| SMILES | [H]/[C-]=N/c1[c-]cccc1.[Y] |
| InChI | InChI=1S/C7H5N.Y/c1-8-7-5-3-2-4-6-7;/h1-5H;/q-2; |
| InChIKey | UPBPUHXNJKZORV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.03 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenylmethanimine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylmethanimine;yttrium?
The IUPAC name of N-phenylmethanimine;yttrium (CID 59968996) is N-phenylmethanimine;yttrium.
What is the SMILES notation for N-phenylmethanimine;yttrium?
The canonical SMILES for N-phenylmethanimine;yttrium is [H]/[C-]=N/c1[c-]cccc1.[Y].
What is the InChIKey of N-phenylmethanimine;yttrium?
The InChIKey is UPBPUHXNJKZORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N.Y/c1-8-7-5-3-2-4-6-7;/h1-5H;/q-2;.
What are the key properties of N-phenylmethanimine;yttrium?
N-phenylmethanimine;yttrium has a molecular weight of 192.03 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylmethanimine;yttrium is sourced from PubChem (CID 59968996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).