About (5R)-1,3,5-trimethylimidazolidine-2,4-dione
(5R)-1,3,5-trimethylimidazolidine-2,4-dione (PubChem CID 59969078) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is (5R)-1,3,5-trimethylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | (5R)-1,3,5-trimethylimidazolidine-2,4-dione |
| PubChem CID | 59969078 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (5R)-1,3,5-trimethylimidazolidine-2,4-dione |
| SMILES | C[C@@H]1C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C6H10N2O2/c1-4-5(9)8(3)6(10)7(4)2/h4H,1-3H3/t4-/m1/s1 |
| InChIKey | LRBZCVZSIVOKEB-SCSAIBSYSA-N |
| XLogP | -0.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze (5R)-1,3,5-trimethylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1,3,5-trimethylimidazolidine-2,4-dione?
The IUPAC name of (5R)-1,3,5-trimethylimidazolidine-2,4-dione (CID 59969078) is (5R)-1,3,5-trimethylimidazolidine-2,4-dione.
What is the SMILES notation for (5R)-1,3,5-trimethylimidazolidine-2,4-dione?
The canonical SMILES for (5R)-1,3,5-trimethylimidazolidine-2,4-dione is C[C@@H]1C(=O)N(C)C(=O)N1C.
What is the InChIKey of (5R)-1,3,5-trimethylimidazolidine-2,4-dione?
The InChIKey is LRBZCVZSIVOKEB-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-4-5(9)8(3)6(10)7(4)2/h4H,1-3H3/t4-/m1/s1.
What are the key properties of (5R)-1,3,5-trimethylimidazolidine-2,4-dione?
(5R)-1,3,5-trimethylimidazolidine-2,4-dione has a molecular weight of 142.16 g/mol, XLogP of -0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1,3,5-trimethylimidazolidine-2,4-dione is sourced from PubChem (CID 59969078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).