C14H30N4 — CID 59969080
(E)-1-N-ethyl-1-N'-[2-[[(E)-1-(ethylamino)but-1-enyl]amino]ethyl]but-1-ene-1,1-diamine (PubChem CID 59969080) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is (E)-1-N-ethyl-1-N'-[2-[[(E)-1-(ethylamino)but-1-enyl]amino]ethyl]but-1-ene-1,1-diamine.
| Compound Name | (E)-1-N-ethyl-1-N'-[2-[[(E)-1-(ethylamino)but-1-enyl]amino]ethyl]but-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 59969080 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | (E)-1-N-ethyl-1-N'-[2-[[(E)-1-(ethylamino)but-1-enyl]amino]ethyl]but-1-ene-1,1-diamine |
| SMILES | CC/C=C(\NCC)NCCN/C(=C/CC)NCC |
| InChI | InChI=1S/C14H30N4/c1-5-9-13(15-7-3)17-11-12-18-14(10-6-2)16-8-4/h9-10,15-18H,5-8,11-12H2,1-4H3/b13-9+,14-10+ |
| InChIKey | RPGBZFIOVAZHNK-UTLPMFLDSA-N |
| XLogP | 1.89 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|