About N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide
N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide (PubChem CID 59969263) has the molecular formula C19H39N3O4
and a molecular weight of 373.54 g/mol. Its IUPAC name is N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide.
Molecular Properties
| Compound Name | N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide |
| PubChem CID | 59969263 |
| Molecular Formula | C19H39N3O4 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.29 |
| IUPAC Name | N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide |
| SMILES | CCCCC(CCCC)(C(=O)NC)C(=O)NCCCN(CCO)CCO |
| InChI | InChI=1S/C19H39N3O4/c1-4-6-9-19(10-7-5-2,17(25)20-3)18(26)21-11-8-12-22(13-15-23)14-16-24/h23-24H,4-16H2,1-3H3,(H,20,25)(H,21,26) |
| InChIKey | MKSOJZJYQDJZHI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide?
The IUPAC name of N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide (CID 59969263) is N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide.
What is the SMILES notation for N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide?
The canonical SMILES for N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide is CCCCC(CCCC)(C(=O)NC)C(=O)NCCCN(CCO)CCO.
What is the InChIKey of N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide?
The InChIKey is MKSOJZJYQDJZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39N3O4/c1-4-6-9-19(10-7-5-2,17(25)20-3)18(26)21-11-8-12-22(13-15-23)14-16-24/h23-24H,4-16H2,1-3H3,(H,20,25)(H,21,26).
What are the key properties of N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide?
N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide has a molecular weight of 373.54 g/mol, XLogP of 0.89, 16 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dibutyl-N'-methylpropanediamide is sourced from PubChem (CID 59969263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).