C13H22F3NO — CID 59970248
2,2,2-trifluoro-N-[[(1S,5S)-1,3,3,5-tetramethylcyclohexyl]methyl]acetamide (PubChem CID 59970248) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(1S,5S)-1,3,3,5-tetramethylcyclohexyl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[(1S,5S)-1,3,3,5-tetramethylcyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 59970248 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(1S,5S)-1,3,3,5-tetramethylcyclohexyl]methyl]acetamide |
| SMILES | C[C@H]1CC(C)(C)C[C@@](C)(CNC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H22F3NO/c1-9-5-11(2,3)7-12(4,6-9)8-17-10(18)13(14,15)16/h9H,5-8H2,1-4H3,(H,17,18)/t9-,12-/m0/s1 |
| InChIKey | RTFOHQWNKIYGQH-CABZTGNLSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |