C13H23N2+ — CID 59970359
[(2Z)-2,3-dimethyl-7-(methylamino)hepta-2,4,6-trienylidene]-propan-2-ylazanium (PubChem CID 59970359) has the molecular formula C13H23N2+ and a molecular weight of 207.34 g/mol. Its IUPAC name is [(2Z)-2,3-dimethyl-7-(methylamino)hepta-2,4,6-trienylidene]-propan-2-ylazanium.
| Compound Name | [(2Z)-2,3-dimethyl-7-(methylamino)hepta-2,4,6-trienylidene]-propan-2-ylazanium |
|---|---|
| PubChem CID | 59970359 |
| Molecular Formula | C13H23N2+ |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.19 |
| IUPAC Name | [(2Z)-2,3-dimethyl-7-(methylamino)hepta-2,4,6-trienylidene]-propan-2-ylazanium |
| SMILES | CNC=CC=C/C(C)=C(C)\C=[NH+]\C(C)C |
| InChI | InChI=1S/C13H22N2/c1-11(2)15-10-13(4)12(3)8-6-7-9-14-5/h6-11,14H,1-5H3/p+1/b8-6?,9-7?,13-12-,15-10+ |
| InChIKey | LDCBZFWWYUCIDB-ZMMZWBKESA-O |
| XLogP | 1.17 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|