About [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane
[(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane (PubChem CID 59970524) has the molecular formula C10H11F2O2P
and a molecular weight of 232.17 g/mol. Its IUPAC name is [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane.
Molecular Properties
| Compound Name | [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane |
| PubChem CID | 59970524 |
| Molecular Formula | C10H11F2O2P |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane |
| SMILES | C[C@@H](OP)C1(c2cc(F)ccc2F)CO1 |
| InChI | InChI=1S/C10H11F2O2P/c1-6(14-15)10(5-13-10)8-4-7(11)2-3-9(8)12/h2-4,6H,5,15H2,1H3/t6-,10?/m1/s1 |
| InChIKey | BBPGYPOFRKRZAA-ZMMDDIOLSA-N |
| XLogP | 2.39 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane?
The IUPAC name of [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane (CID 59970524) is [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane.
What is the SMILES notation for [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane?
The canonical SMILES for [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane is C[C@@H](OP)C1(c2cc(F)ccc2F)CO1.
What is the InChIKey of [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane?
The InChIKey is BBPGYPOFRKRZAA-ZMMDDIOLSA-N. The full InChI is InChI=1S/C10H11F2O2P/c1-6(14-15)10(5-13-10)8-4-7(11)2-3-9(8)12/h2-4,6H,5,15H2,1H3/t6-,10?/m1/s1.
What are the key properties of [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane?
[(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane has a molecular weight of 232.17 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]phosphane is sourced from PubChem (CID 59970524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).