About 1-ethoxy-4-methylbenzene;yttrium
1-ethoxy-4-methylbenzene;yttrium (PubChem CID 59970582) has the molecular formula C9H11OY-
and a molecular weight of 224.09 g/mol. Its IUPAC name is 1-ethoxy-4-methylbenzene;yttrium.
Molecular Properties
| Compound Name | 1-ethoxy-4-methylbenzene;yttrium |
| PubChem CID | 59970582 |
| Molecular Formula | C9H11OY- |
| Molecular Weight | 224.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 1-ethoxy-4-methylbenzene;yttrium |
| SMILES | [CH2-]COc1ccc(C)cc1.[Y] |
| InChI | InChI=1S/C9H11O.Y/c1-3-10-9-6-4-8(2)5-7-9;/h4-7H,1,3H2,2H3;/q-1; |
| InChIKey | QUUBKOFZDJRJNY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-4-methylbenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-4-methylbenzene;yttrium?
The IUPAC name of 1-ethoxy-4-methylbenzene;yttrium (CID 59970582) is 1-ethoxy-4-methylbenzene;yttrium.
What is the SMILES notation for 1-ethoxy-4-methylbenzene;yttrium?
The canonical SMILES for 1-ethoxy-4-methylbenzene;yttrium is [CH2-]COc1ccc(C)cc1.[Y].
What is the InChIKey of 1-ethoxy-4-methylbenzene;yttrium?
The InChIKey is QUUBKOFZDJRJNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O.Y/c1-3-10-9-6-4-8(2)5-7-9;/h4-7H,1,3H2,2H3;/q-1;.
What are the key properties of 1-ethoxy-4-methylbenzene;yttrium?
1-ethoxy-4-methylbenzene;yttrium has a molecular weight of 224.09 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-4-methylbenzene;yttrium is sourced from PubChem (CID 59970582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).