About methylsulfanyl but-2-enoate
methylsulfanyl but-2-enoate (PubChem CID 59970961) has the molecular formula C5H8O2S
and a molecular weight of 132.18 g/mol. Its IUPAC name is methylsulfanyl but-2-enoate.
Molecular Properties
| Compound Name | methylsulfanyl but-2-enoate |
| PubChem CID | 59970961 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | methylsulfanyl but-2-enoate |
| SMILES | CC=CC(=O)OSC |
| InChI | InChI=1S/C5H8O2S/c1-3-4-5(6)7-8-2/h3-4H,1-2H3 |
| InChIKey | WWJRTTXEHZCFHB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanyl but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanyl but-2-enoate?
The IUPAC name of methylsulfanyl but-2-enoate (CID 59970961) is methylsulfanyl but-2-enoate.
What is the SMILES notation for methylsulfanyl but-2-enoate?
The canonical SMILES for methylsulfanyl but-2-enoate is CC=CC(=O)OSC.
What is the InChIKey of methylsulfanyl but-2-enoate?
The InChIKey is WWJRTTXEHZCFHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S/c1-3-4-5(6)7-8-2/h3-4H,1-2H3.
What are the key properties of methylsulfanyl but-2-enoate?
methylsulfanyl but-2-enoate has a molecular weight of 132.18 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanyl but-2-enoate is sourced from PubChem (CID 59970961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).