C15H28O6 — CID 59971088
[(4S)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl] octanoate (PubChem CID 59971088) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is [(4S)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl] octanoate.
| Compound Name | [(4S)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl] octanoate |
|---|---|
| PubChem CID | 59971088 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | [(4S)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl] octanoate |
| SMILES | CCCCCCCC(=O)OC1CC(CO)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C15H28O6/c1-2-3-4-5-6-7-12(17)21-11-8-10(9-16)13(18)15(20)14(11)19/h10-11,13-16,18-20H,2-9H2,1H3/t10?,11?,13-,14?,15?/m0/s1 |
| InChIKey | GXQAOJXPTKQNOU-QIUSFHBQSA-N |
| XLogP | 0.35 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|