C9H18N2O3Y-2 — CID 59971091
carbanide;[1-(1-carboxypropan-2-ylamino)-1-oxopropan-2-yl]-methylazanide;yttrium (PubChem CID 59971091) has the molecular formula C9H18N2O3Y-2 and a molecular weight of 291.16 g/mol. Its IUPAC name is carbanide;[1-(1-carboxypropan-2-ylamino)-1-oxopropan-2-yl]-methylazanide;yttrium.
| Compound Name | carbanide;[1-(1-carboxypropan-2-ylamino)-1-oxopropan-2-yl]-methylazanide;yttrium |
|---|---|
| PubChem CID | 59971091 |
| Molecular Formula | C9H18N2O3Y-2 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | carbanide;[1-(1-carboxypropan-2-ylamino)-1-oxopropan-2-yl]-methylazanide;yttrium |
| SMILES | C[N-]C(C)C(=O)NC(C)CC(=O)O.[CH3-].[Y] |
| InChI | InChI=1S/C8H15N2O3.CH3.Y/c1-5(4-7(11)12)10-8(13)6(2)9-3;;/h5-6H,4H2,1-3H3,(H,10,13)(H,11,12);1H3;/q2*-1; |
| InChIKey | GJMIBBNXVXWVKR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|