About 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid
3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid (PubChem CID 59971160) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid |
| PubChem CID | 59971160 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid |
| SMILES | CO[C@@H]1C[C@@H](CO)N(CCC(=O)O)C1 |
| InChI | InChI=1S/C9H17NO4/c1-14-8-4-7(6-11)10(5-8)3-2-9(12)13/h7-8,11H,2-6H2,1H3,(H,12,13)/t7-,8+/m0/s1 |
| InChIKey | OCHUMKYGULLVDS-JGVFFNPUSA-N |
| XLogP | -0.46 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid?
The IUPAC name of 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid (CID 59971160) is 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid.
What is the SMILES notation for 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid?
The canonical SMILES for 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid is CO[C@@H]1C[C@@H](CO)N(CCC(=O)O)C1.
What is the InChIKey of 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid?
The InChIKey is OCHUMKYGULLVDS-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H17NO4/c1-14-8-4-7(6-11)10(5-8)3-2-9(12)13/h7-8,11H,2-6H2,1H3,(H,12,13)/t7-,8+/m0/s1.
What are the key properties of 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid?
3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid has a molecular weight of 203.24 g/mol, XLogP of -0.46, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propanoic acid is sourced from PubChem (CID 59971160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).