C12H22AcINO2 — CID 59971179
actinium;3-[(E)-5-(123I)iodo-1-methoxypent-4-enyl]-1-methylpiperidin-4-ol (PubChem CID 59971179) has the molecular formula C12H22AcINO2 and a molecular weight of 562.22 g/mol. Its IUPAC name is actinium;3-[(E)-5-(123I)iodo-1-methoxypent-4-enyl]-1-methylpiperidin-4-ol.
| Compound Name | actinium;3-[(E)-5-(123I)iodo-1-methoxypent-4-enyl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 59971179 |
| Molecular Formula | C12H22AcINO2 |
| Molecular Weight | 562.22 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | actinium;3-[(E)-5-(123I)iodo-1-methoxypent-4-enyl]-1-methylpiperidin-4-ol |
| SMILES | COC(CC/C=C/[123I])C1CN(C)CCC1O.[Ac] |
| InChI | InChI=1S/C12H22INO2.Ac/c1-14-8-6-11(15)10(9-14)12(16-2)5-3-4-7-13;/h4,7,10-12,15H,3,5-6,8-9H2,1-2H3;/b7-4+;/i13-4; |
| InChIKey | DIFZWNDRILOEGC-OQJKJFBQSA-N |
| XLogP | 2.04 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|