C23H20CuN4O2 — CID 59971375
copper (2-hydroxy-3,5-dimethylphenyl)-[(Z)-[[[5-methyl-2-(oxomethyl)phenyl]diazenyl]-phenylmethylidene]amino]azanide (PubChem CID 59971375) has the molecular formula C23H20CuN4O2 and a molecular weight of 447.99 g/mol. Its IUPAC name is copper (2-hydroxy-3,5-dimethylphenyl)-[(Z)-[[[5-methyl-2-(oxomethyl)phenyl]diazenyl]-phenylmethylidene]amino]azanide.
| Compound Name | copper (2-hydroxy-3,5-dimethylphenyl)-[(Z)-[[[5-methyl-2-(oxomethyl)phenyl]diazenyl]-phenylmethylidene]amino]azanide |
|---|---|
| PubChem CID | 59971375 |
| Molecular Formula | C23H20CuN4O2 |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | copper (2-hydroxy-3,5-dimethylphenyl)-[(Z)-[[[5-methyl-2-(oxomethyl)phenyl]diazenyl]-phenylmethylidene]amino]azanide |
| SMILES | Cc1ccc([C-]=O)c(/N=N/C(=N\[N-]c2cc(C)cc(C)c2O)c2ccccc2)c1.[Cu+2] |
| InChI | InChI=1S/C23H20N4O2.Cu/c1-15-9-10-19(14-28)20(12-15)24-26-23(18-7-5-4-6-8-18)27-25-21-13-16(2)11-17(3)22(21)29;/h4-13H,1-3H3,(H-,24,25,26,27,28,29);/q-2;+2 |
| InChIKey | RDIMUXQIVSKEJG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|