C23H48O3Si — CID 59971403
tert-butyl-[(E,2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoxy]-dimethylsilane (PubChem CID 59971403) has the molecular formula C23H48O3Si and a molecular weight of 400.72 g/mol. Its IUPAC name is tert-butyl-[(E,2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59971403 |
| Molecular Formula | C23H48O3Si |
| Molecular Weight | 400.72 g/mol |
| Exact Mass | 400.34 |
| IUPAC Name | tert-butyl-[(E,2R,3R)-3-[3-(methoxymethoxy)propyl]-6-methyl-2-(2-methylpropyl)hept-4-enoxy]-dimethylsilane |
| SMILES | COCOCCCC(/C=C/C(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)CC(C)C |
| InChI | InChI=1S/C23H48O3Si/c1-19(2)13-14-21(12-11-15-25-18-24-8)22(16-20(3)4)17-26-27(9,10)23(5,6)7/h13-14,19-22H,11-12,15-18H2,1-10H3/b14-13+/t21?,22-/m0/s1 |
| InChIKey | AUNABUNEFZEQFV-UXZIUYSTSA-N |
| XLogP | 6.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.72 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|