C20H32N2O3 — CID 59971418
(2S)-3-methyl-2-[[(4Z,6Z)-nona-4,6,8-trien-2-yl]-(2-oxopropanoyl)amino]-N-propan-2-ylbutanamide (PubChem CID 59971418) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(4Z,6Z)-nona-4,6,8-trien-2-yl]-(2-oxopropanoyl)amino]-N-propan-2-ylbutanamide.
| Compound Name | (2S)-3-methyl-2-[[(4Z,6Z)-nona-4,6,8-trien-2-yl]-(2-oxopropanoyl)amino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 59971418 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (2S)-3-methyl-2-[[(4Z,6Z)-nona-4,6,8-trien-2-yl]-(2-oxopropanoyl)amino]-N-propan-2-ylbutanamide |
| SMILES | C=C/C=C\C=C/CC(C)N(C(=O)C(C)=O)[C@H](C(=O)NC(C)C)C(C)C |
| InChI | InChI=1S/C20H32N2O3/c1-8-9-10-11-12-13-16(6)22(20(25)17(7)23)18(14(2)3)19(24)21-15(4)5/h8-12,14-16,18H,1,13H2,2-7H3,(H,21,24)/b10-9-,12-11-/t16?,18-/m0/s1 |
| InChIKey | VOYMZPPTYVNLOB-SYGJJOJUSA-N |
| XLogP | 3.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|