C24H20O2 — CID 59971454
(9R)-10-methyl-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carbaldehyde (PubChem CID 59971454) has the molecular formula C24H20O2 and a molecular weight of 340.42 g/mol. Its IUPAC name is (9R)-10-methyl-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carbaldehyde.
| Compound Name | (9R)-10-methyl-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carbaldehyde |
|---|---|
| PubChem CID | 59971454 |
| Molecular Formula | C24H20O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (9R)-10-methyl-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carbaldehyde |
| SMILES | CC1[C@@H](C=O)C2(c3ccccc3)OC1(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C24H20O2/c1-17-22(16-25)24(19-12-6-3-7-13-19)21-15-9-8-14-20(21)23(17,26-24)18-10-4-2-5-11-18/h2-17,22H,1H3/t17?,22-,23?,24?/m1/s1 |
| InChIKey | FALKUKGYEQFCGD-CLZPHKAASA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|