About CID 59971475
CID 59971475 (PubChem CID 59971475) has the molecular formula C23H42O5
and a molecular weight of 398.58 g/mol.
Molecular Properties
| Compound Name | CID 59971475 |
| PubChem CID | 59971475 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | — |
| SMILES | [CH]OC(COCC=C)COCC1COC(CCCCCC)(CCCCCC)O1 |
| InChI | InChI=1S/C23H42O5/c1-5-8-10-12-14-23(15-13-11-9-6-2)27-20-22(28-23)19-26-18-21(24-4)17-25-16-7-3/h4,7,21-22H,3,5-6,8-20H2,1-2H3 |
| InChIKey | GFOOLRALSKJWSA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 59971475 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59971475?
The IUPAC name of CID 59971475 (CID 59971475) is not available.
What is the SMILES notation for CID 59971475?
The canonical SMILES for CID 59971475 is [CH]OC(COCC=C)COCC1COC(CCCCCC)(CCCCCC)O1.
What is the InChIKey of CID 59971475?
The InChIKey is GFOOLRALSKJWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42O5/c1-5-8-10-12-14-23(15-13-11-9-6-2)27-20-22(28-23)19-26-18-21(24-4)17-25-16-7-3/h4,7,21-22H,3,5-6,8-20H2,1-2H3.
What are the key properties of CID 59971475?
CID 59971475 has a molecular weight of 398.58 g/mol, XLogP of 5.31, 19 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59971475 is sourced from PubChem (CID 59971475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).