C26H45NO4 — CID 59971516
methyl 4-[(1R,10aS,12aR)-8-amino-5,12-dihydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]pentanoate (PubChem CID 59971516) has the molecular formula C26H45NO4 and a molecular weight of 435.65 g/mol. Its IUPAC name is methyl 4-[(1R,10aS,12aR)-8-amino-5,12-dihydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]pentanoate.
| Compound Name | methyl 4-[(1R,10aS,12aR)-8-amino-5,12-dihydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]pentanoate |
|---|---|
| PubChem CID | 59971516 |
| Molecular Formula | C26H45NO4 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.33 |
| IUPAC Name | methyl 4-[(1R,10aS,12aR)-8-amino-5,12-dihydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]pentanoate |
| SMILES | COC(=O)CCC(C)[C@H]1CCCC2C3C(O)CC4CC(N)CC[C@]4(C)C3CC(O)[C@@]21C |
| InChI | InChI=1S/C26H45NO4/c1-15(8-9-23(30)31-4)18-6-5-7-19-24-20(14-22(29)26(18,19)3)25(2)11-10-17(27)12-16(25)13-21(24)28/h15-22,24,28-29H,5-14,27H2,1-4H3/t15?,16?,17?,18-,19?,20?,21?,22?,24?,25+,26-/m1/s1 |
| InChIKey | DLJHDCLOZZUONQ-URGNMFQTSA-N |
| XLogP | 3.89 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |