C38H46N2Si — CID 59971535
3-[4-[[4-[4-(dimethylamino)-3-methylbut-2-en-2-yl]phenyl]-diphenylsilyl]phenyl]-N,N,2-trimethylbut-2-en-1-amine (PubChem CID 59971535) has the molecular formula C38H46N2Si and a molecular weight of 558.89 g/mol. Its IUPAC name is 3-[4-[[4-[4-(dimethylamino)-3-methylbut-2-en-2-yl]phenyl]-diphenylsilyl]phenyl]-N,N,2-trimethylbut-2-en-1-amine.
| Compound Name | 3-[4-[[4-[4-(dimethylamino)-3-methylbut-2-en-2-yl]phenyl]-diphenylsilyl]phenyl]-N,N,2-trimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 59971535 |
| Molecular Formula | C38H46N2Si |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | 3-[4-[[4-[4-(dimethylamino)-3-methylbut-2-en-2-yl]phenyl]-diphenylsilyl]phenyl]-N,N,2-trimethylbut-2-en-1-amine |
| SMILES | CC(CN(C)C)=C(C)c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(C(C)=C(C)CN(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H46N2Si/c1-29(27-39(5)6)31(3)33-19-23-37(24-20-33)41(35-15-11-9-12-16-35,36-17-13-10-14-18-36)38-25-21-34(22-26-38)32(4)30(2)28-40(7)8/h9-26H,27-28H2,1-8H3 |
| InChIKey | FLLQJZICSHNOPF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|