C29H41N5O4 — CID 59971592
(2S)-2-[[1-[[(2S)-2-(methylamino)butanoyl]amino]cyclohexanecarbonyl]amino]-N-(3-naphthalen-1-ylpropyl)butanediamide (PubChem CID 59971592) has the molecular formula C29H41N5O4 and a molecular weight of 523.68 g/mol. Its IUPAC name is (2S)-2-[[1-[[(2S)-2-(methylamino)butanoyl]amino]cyclohexanecarbonyl]amino]-N-(3-naphthalen-1-ylpropyl)butanediamide.
| Compound Name | (2S)-2-[[1-[[(2S)-2-(methylamino)butanoyl]amino]cyclohexanecarbonyl]amino]-N-(3-naphthalen-1-ylpropyl)butanediamide |
|---|---|
| PubChem CID | 59971592 |
| Molecular Formula | C29H41N5O4 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | (2S)-2-[[1-[[(2S)-2-(methylamino)butanoyl]amino]cyclohexanecarbonyl]amino]-N-(3-naphthalen-1-ylpropyl)butanediamide |
| SMILES | CC[C@H](NC)C(=O)NC1(C(=O)N[C@@H](CC(N)=O)C(=O)NCCCc2cccc3ccccc23)CCCCC1 |
| InChI | InChI=1S/C29H41N5O4/c1-3-23(31-2)27(37)34-29(16-7-4-8-17-29)28(38)33-24(19-25(30)35)26(36)32-18-10-14-21-13-9-12-20-11-5-6-15-22(20)21/h5-6,9,11-13,15,23-24,31H,3-4,7-8,10,14,16-19H2,1-2H3,(H2,30,35)(H,32,36)(H,33,38)(H,34,37)/t23-,24-/m0/s1 |
| InChIKey | HJPKKFDUCLGXQB-ZEQRLZLVSA-N |
| XLogP | 2.07 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|