C19H27NO2 — CID 59972003
methyl (2E)-2-[1-methyl-3-(2,3,4,5-tetramethylphenyl)piperidin-4-ylidene]acetate (PubChem CID 59972003) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is methyl (2E)-2-[1-methyl-3-(2,3,4,5-tetramethylphenyl)piperidin-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[1-methyl-3-(2,3,4,5-tetramethylphenyl)piperidin-4-ylidene]acetate |
|---|---|
| PubChem CID | 59972003 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | methyl (2E)-2-[1-methyl-3-(2,3,4,5-tetramethylphenyl)piperidin-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CCN(C)CC1c1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C19H27NO2/c1-12-9-17(15(4)14(3)13(12)2)18-11-20(5)8-7-16(18)10-19(21)22-6/h9-10,18H,7-8,11H2,1-6H3/b16-10+ |
| InChIKey | HSTGLBRCABPIQA-MHWRWJLKSA-N |
| XLogP | 3.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|