C10H18N4 — CID 59972098
(1Z,5Z,8Z)-2,3,7-trimethyl-1,3,6,8-tetrazacycloundeca-5,8,11-triene (PubChem CID 59972098) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (1Z,5Z,8Z)-2,3,7-trimethyl-1,3,6,8-tetrazacycloundeca-5,8,11-triene.
| Compound Name | (1Z,5Z,8Z)-2,3,7-trimethyl-1,3,6,8-tetrazacycloundeca-5,8,11-triene |
|---|---|
| PubChem CID | 59972098 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (1Z,5Z,8Z)-2,3,7-trimethyl-1,3,6,8-tetrazacycloundeca-5,8,11-triene |
| SMILES | CC1/N=C\C/C=N\C(C)N(C)C/C=N\1 |
| InChI | InChI=1S/C10H18N4/c1-9-11-5-4-6-13-10(2)14(3)8-7-12-9/h5-7,9-10H,4,8H2,1-3H3/b11-5-,12-7-,13-6- |
| InChIKey | OHDANUXLILJTIP-GATXABDHSA-N |
| XLogP | 1.23 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |