C18H38O4Si2 — CID 59973077
(6aR,9aS)-8-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine (PubChem CID 59973077) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is (6aR,9aS)-8-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine.
| Compound Name | (6aR,9aS)-8-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 59973077 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (6aR,9aS)-8-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
| SMILES | CC1C[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O1 |
| InChI | InChI=1S/C18H38O4Si2/c1-12(2)23(13(3)4)19-11-18-17(10-16(9)20-18)21-24(22-23,14(5)6)15(7)8/h12-18H,10-11H2,1-9H3/t16?,17-,18+/m0/s1 |
| InChIKey | FSKJEQOULHKOPR-UQJFVLDMSA-N |
| XLogP | 5.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|