C13H27N3O3 — CID 59973091
tert-butyl N-[(2S)-1-[ethyl-[2-(methylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 59973091) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[ethyl-[2-(methylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[ethyl-[2-(methylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 59973091 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-[ethyl-[2-(methylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCN(CCNC)C(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27N3O3/c1-7-16(9-8-14-6)11(17)10(2)15-12(18)19-13(3,4)5/h10,14H,7-9H2,1-6H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | JODFKYABDBWERB-JTQLQIEISA-N |
| XLogP | 0.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |