About 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium
4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium (PubChem CID 59973112) has the molecular formula C9H8NOY-
and a molecular weight of 235.07 g/mol. Its IUPAC name is 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium.
Molecular Properties
| Compound Name | 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium |
| PubChem CID | 59973112 |
| Molecular Formula | C9H8NOY- |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium |
| SMILES | Cc1[c-]ccc2c1CC(=O)N2.[Y] |
| InChI | InChI=1S/C9H8NO.Y/c1-6-3-2-4-8-7(6)5-9(11)10-8;/h2,4H,5H2,1H3,(H,10,11);/q-1; |
| InChIKey | CCRYENNGCSMIRN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium?
The IUPAC name of 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium (CID 59973112) is 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium.
What is the SMILES notation for 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium?
The canonical SMILES for 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium is Cc1[c-]ccc2c1CC(=O)N2.[Y].
What is the InChIKey of 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium?
The InChIKey is CCRYENNGCSMIRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8NO.Y/c1-6-3-2-4-8-7(6)5-9(11)10-8;/h2,4H,5H2,1H3,(H,10,11);/q-1;.
What are the key properties of 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium?
4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium has a molecular weight of 235.07 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,5-dihydro-1H-indol-5-id-2-one;yttrium is sourced from PubChem (CID 59973112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).