About CID 59973247
CID 59973247 (PubChem CID 59973247) has the molecular formula C25H25Cl2N2O5S+
and a molecular weight of 536.46 g/mol.
Molecular Properties
| Compound Name | CID 59973247 |
| PubChem CID | 59973247 |
| Molecular Formula | C25H25Cl2N2O5S+ |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | — |
| SMILES | [CH]CC[n+]1c(/C=C(\C=C2\Oc3ccc(Cl)cc3N2CCCS(=O)(=O)O)CC)oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H24Cl2N2O5S/c1-3-10-28-20-15-18(26)6-8-22(20)33-24(28)13-17(4-2)14-25-29(11-5-12-35(30,31)32)21-16-19(27)7-9-23(21)34-25/h1,6-9,13-16H,3-5,10-12H2,2H3/p+1 |
| InChIKey | AWAABPANLZNSAN-UHFFFAOYSA-O |
| XLogP | 5.94 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 59973247 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59973247?
The IUPAC name of CID 59973247 (CID 59973247) is not available.
What is the SMILES notation for CID 59973247?
The canonical SMILES for CID 59973247 is [CH]CC[n+]1c(/C=C(\C=C2\Oc3ccc(Cl)cc3N2CCCS(=O)(=O)O)CC)oc2ccc(Cl)cc21.
What is the InChIKey of CID 59973247?
The InChIKey is AWAABPANLZNSAN-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H24Cl2N2O5S/c1-3-10-28-20-15-18(26)6-8-22(20)33-24(28)13-17(4-2)14-25-29(11-5-12-35(30,31)32)21-16-19(27)7-9-23(21)34-25/h1,6-9,13-16H,3-5,10-12H2,2H3/p+1.
What are the key properties of CID 59973247?
CID 59973247 has a molecular weight of 536.46 g/mol, XLogP of 5.94, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59973247 is sourced from PubChem (CID 59973247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).