C17H17N3O3 — CID 59973321
3-[2,4-dimethyl-5-[(Z)-(2-oxo-1H-pyrrolo[2,3-b]pyridin-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid (PubChem CID 59973321) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[2,4-dimethyl-5-[(Z)-(2-oxo-1H-pyrrolo[2,3-b]pyridin-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[2,4-dimethyl-5-[(Z)-(2-oxo-1H-pyrrolo[2,3-b]pyridin-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 59973321 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[2,4-dimethyl-5-[(Z)-(2-oxo-1H-pyrrolo[2,3-b]pyridin-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ncccc32)c(C)c1CCC(=O)O |
| InChI | InChI=1S/C17H17N3O3/c1-9-11(5-6-15(21)22)10(2)19-14(9)8-13-12-4-3-7-18-16(12)20-17(13)23/h3-4,7-8,19H,5-6H2,1-2H3,(H,21,22)(H,18,20,23)/b13-8- |
| InChIKey | HUXAKLZGDKLPFO-JYRVWZFOSA-N |
| XLogP | 2.54 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|