About (E)-2-bromopent-2-ene;tris(yttrium)
(E)-2-bromopent-2-ene;tris(yttrium) (PubChem CID 59973588) has the molecular formula C5H8BrY3-
and a molecular weight of 414.74 g/mol. Its IUPAC name is (E)-2-bromopent-2-ene;tris(yttrium).
Molecular Properties
| Compound Name | (E)-2-bromopent-2-ene;tris(yttrium) |
| PubChem CID | 59973588 |
| Molecular Formula | C5H8BrY3- |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 413.70 |
| IUPAC Name | (E)-2-bromopent-2-ene;tris(yttrium) |
| SMILES | C[CH-]/C=C(\C)Br.[Y].[Y].[Y] |
| InChI | InChI=1S/C5H8Br.3Y/c1-3-4-5(2)6;;;/h3-4H,1-2H3;;;/q-1;;;/b5-4+;;; |
| InChIKey | AFRRFTAMPRTCDR-WVFFXBQBSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-bromopent-2-ene;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-bromopent-2-ene;tris(yttrium)?
The IUPAC name of (E)-2-bromopent-2-ene;tris(yttrium) (CID 59973588) is (E)-2-bromopent-2-ene;tris(yttrium).
What is the SMILES notation for (E)-2-bromopent-2-ene;tris(yttrium)?
The canonical SMILES for (E)-2-bromopent-2-ene;tris(yttrium) is C[CH-]/C=C(\C)Br.[Y].[Y].[Y].
What is the InChIKey of (E)-2-bromopent-2-ene;tris(yttrium)?
The InChIKey is AFRRFTAMPRTCDR-WVFFXBQBSA-N. The full InChI is InChI=1S/C5H8Br.3Y/c1-3-4-5(2)6;;;/h3-4H,1-2H3;;;/q-1;;;/b5-4+;;;.
What are the key properties of (E)-2-bromopent-2-ene;tris(yttrium)?
(E)-2-bromopent-2-ene;tris(yttrium) has a molecular weight of 414.74 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-bromopent-2-ene;tris(yttrium) is sourced from PubChem (CID 59973588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).