C9H17BrO — CID 59973681
(2S,5R)-2-bromo-3,4,5,6-tetramethyloxane (PubChem CID 59973681) has the molecular formula C9H17BrO and a molecular weight of 221.14 g/mol. Its IUPAC name is (2S,5R)-2-bromo-3,4,5,6-tetramethyloxane.
| Compound Name | (2S,5R)-2-bromo-3,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 59973681 |
| Molecular Formula | C9H17BrO |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (2S,5R)-2-bromo-3,4,5,6-tetramethyloxane |
| SMILES | CC1O[C@@H](Br)C(C)C(C)[C@H]1C |
| InChI | InChI=1S/C9H17BrO/c1-5-6(2)8(4)11-9(10)7(5)3/h5-9H,1-4H3/t5?,6-,7?,8?,9-/m1/s1 |
| InChIKey | QCMJJUWYQRBJTK-LXMFVISSSA-N |
| XLogP | 3.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|