C24H26N4O4 — CID 59974096
(4E)-2-[4-(dihydroxymethyl)phenyl]-4-[(E)-3-(5-hydroxy-3-methyl-1-phenylpyrazolidin-4-yl)prop-2-enylidene]-5-methylpyrazol-3-one (PubChem CID 59974096) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is (4E)-2-[4-(dihydroxymethyl)phenyl]-4-[(E)-3-(5-hydroxy-3-methyl-1-phenylpyrazolidin-4-yl)prop-2-enylidene]-5-methylpyrazol-3-one.
| Compound Name | (4E)-2-[4-(dihydroxymethyl)phenyl]-4-[(E)-3-(5-hydroxy-3-methyl-1-phenylpyrazolidin-4-yl)prop-2-enylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 59974096 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (4E)-2-[4-(dihydroxymethyl)phenyl]-4-[(E)-3-(5-hydroxy-3-methyl-1-phenylpyrazolidin-4-yl)prop-2-enylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2ccc(C(O)O)cc2)C(=O)/C1=C/C=C/C1C(C)NN(c2ccccc2)C1O |
| InChI | InChI=1S/C24H26N4O4/c1-15-20(22(29)27(25-15)18-7-4-3-5-8-18)9-6-10-21-16(2)26-28(23(21)30)19-13-11-17(12-14-19)24(31)32/h3-15,20,22,24-25,29,31-32H,1-2H3/b9-6+,21-10+ |
| InChIKey | IVFOQJIFPIBIHH-DVMKSOMISA-N |
| XLogP | 2.22 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|