About (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran
(3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran (PubChem CID 59974305) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran |
| PubChem CID | 59974305 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran |
| SMILES | CCC1OC=CC(C)[C@H]1C |
| InChI | InChI=1S/C9H16O/c1-4-9-8(3)7(2)5-6-10-9/h5-9H,4H2,1-3H3/t7?,8-,9?/m1/s1 |
| InChIKey | PSAAZYPFGIMEMJ-QJAFJHJLSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran?
The IUPAC name of (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran (CID 59974305) is (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran?
The canonical SMILES for (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran is CCC1OC=CC(C)[C@H]1C.
What is the InChIKey of (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran?
The InChIKey is PSAAZYPFGIMEMJ-QJAFJHJLSA-N. The full InChI is InChI=1S/C9H16O/c1-4-9-8(3)7(2)5-6-10-9/h5-9H,4H2,1-3H3/t7?,8-,9?/m1/s1.
What are the key properties of (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran?
(3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran has a molecular weight of 140.23 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 59974305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).