About (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone
(4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone (PubChem CID 59974568) has the molecular formula C15H12N4OS
and a molecular weight of 296.36 g/mol. Its IUPAC name is (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone.
Molecular Properties
| Compound Name | (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone |
| PubChem CID | 59974568 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone |
| SMILES | Nc1nc(Nc2ccccc2)sc1C(=O)c1cccnc1 |
| InChI | InChI=1S/C15H12N4OS/c16-14-13(12(20)10-5-4-8-17-9-10)21-15(19-14)18-11-6-2-1-3-7-11/h1-9H,16H2,(H,18,19) |
| InChIKey | LERGLIZTDGVNRO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone?
The IUPAC name of (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone (CID 59974568) is (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone.
What is the SMILES notation for (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone?
The canonical SMILES for (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone is Nc1nc(Nc2ccccc2)sc1C(=O)c1cccnc1.
What is the InChIKey of (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone?
The InChIKey is LERGLIZTDGVNRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4OS/c16-14-13(12(20)10-5-4-8-17-9-10)21-15(19-14)18-11-6-2-1-3-7-11/h1-9H,16H2,(H,18,19).
What are the key properties of (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone?
(4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone has a molecular weight of 296.36 g/mol, XLogP of 3.09, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanone is sourced from PubChem (CID 59974568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).