C17H16F6N6 — CID 59974905
N'-amino-4-[2-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzenecarboximidamide (PubChem CID 59974905) has the molecular formula C17H16F6N6 and a molecular weight of 418.35 g/mol. Its IUPAC name is N'-amino-4-[2-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzenecarboximidamide.
| Compound Name | N'-amino-4-[2-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 59974905 |
| Molecular Formula | C17H16F6N6 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N'-amino-4-[2-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzenecarboximidamide |
| SMILES | N/N=C(\N)c1ccc(C(c2ccc(/C(N)=N/N)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F6N6/c18-16(19,20)15(17(21,22)23,11-5-1-9(2-6-11)13(24)28-26)12-7-3-10(4-8-12)14(25)29-27/h1-8H,26-27H2,(H2,24,28)(H2,25,29) |
| InChIKey | WSWMIUDGYCTSMA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|