About methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate
methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate (PubChem CID 59975131) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate |
| PubChem CID | 59975131 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate |
| SMILES | CNc1ccc2n(c1=O)C(C(=O)OC)CC2 |
| InChI | InChI=1S/C11H14N2O3/c1-12-8-5-3-7-4-6-9(11(15)16-2)13(7)10(8)14/h3,5,9,12H,4,6H2,1-2H3 |
| InChIKey | JKYJVMKEJKVGMU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The IUPAC name of methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate (CID 59975131) is methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate.
What is the SMILES notation for methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The canonical SMILES for methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate is CNc1ccc2n(c1=O)C(C(=O)OC)CC2.
What is the InChIKey of methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The InChIKey is JKYJVMKEJKVGMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3/c1-12-8-5-3-7-4-6-9(11(15)16-2)13(7)10(8)14/h3,5,9,12H,4,6H2,1-2H3.
What are the key properties of methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate has a molecular weight of 222.24 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate is sourced from PubChem (CID 59975131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).