About [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate
[diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate (PubChem CID 59975139) has the molecular formula C13H24N2O3P4
and a molecular weight of 380.24 g/mol. Its IUPAC name is [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate.
Molecular Properties
| Compound Name | [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate |
| PubChem CID | 59975139 |
| Molecular Formula | C13H24N2O3P4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate |
| SMILES | Cc1c(C)c(C)n(C(C)C(=O)OP(P)PP)c(=O)c1N(C)C |
| InChI | InChI=1S/C13H24N2O3P4/c1-7-8(2)11(14(5)6)12(16)15(9(7)3)10(4)13(17)18-22(20)21-19/h10,21H,19-20H2,1-6H3 |
| InChIKey | PYFOZZYWZNRVQE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate?
The IUPAC name of [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate (CID 59975139) is [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate.
What is the SMILES notation for [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate?
The canonical SMILES for [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate is Cc1c(C)c(C)n(C(C)C(=O)OP(P)PP)c(=O)c1N(C)C.
What is the InChIKey of [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate?
The InChIKey is PYFOZZYWZNRVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3P4/c1-7-8(2)11(14(5)6)12(16)15(9(7)3)10(4)13(17)18-22(20)21-19/h10,21H,19-20H2,1-6H3.
What are the key properties of [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate?
[diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate has a molecular weight of 380.24 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [diphosphanyl(phosphanyl)phosphanyl] 2-[5-(dimethylamino)-2,3,4-trimethyl-6-oxo-1-pyridinyl]propanoate is sourced from PubChem (CID 59975139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).