C18H24N4O4 — CID 59975151
(3S)-N-[(E,4S)-1-amino-1,7-dioxooct-5-en-4-yl]-6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxamide (PubChem CID 59975151) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (3S)-N-[(E,4S)-1-amino-1,7-dioxooct-5-en-4-yl]-6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxamide.
| Compound Name | (3S)-N-[(E,4S)-1-amino-1,7-dioxooct-5-en-4-yl]-6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxamide |
|---|---|
| PubChem CID | 59975151 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (3S)-N-[(E,4S)-1-amino-1,7-dioxooct-5-en-4-yl]-6-(methylamino)-5-oxo-2,3-dihydro-1H-indolizine-3-carboxamide |
| SMILES | CNc1ccc2n(c1=O)[C@H](C(=O)N[C@H](/C=C/C(C)=O)CCC(N)=O)CC2 |
| InChI | InChI=1S/C18H24N4O4/c1-11(23)3-4-12(5-10-16(19)24)21-17(25)15-9-7-13-6-8-14(20-2)18(26)22(13)15/h3-4,6,8,12,15,20H,5,7,9-10H2,1-2H3,(H2,19,24)(H,21,25)/b4-3+/t12-,15+/m1/s1 |
| InChIKey | QOAWUQJJHZLSJL-FMZFVKQPSA-N |
| XLogP | 0.27 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|