C14H20O2 — CID 59975413
(1R,3aR,9aS)-1,9-dimethyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one (PubChem CID 59975413) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (1R,3aR,9aS)-1,9-dimethyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one.
| Compound Name | (1R,3aR,9aS)-1,9-dimethyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 59975413 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1R,3aR,9aS)-1,9-dimethyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one |
| SMILES | CC1C2CCCCC2=C[C@H]2C(=O)O[C@H](C)[C@@H]12 |
| InChI | InChI=1S/C14H20O2/c1-8-11-6-4-3-5-10(11)7-12-13(8)9(2)16-14(12)15/h7-9,11-13H,3-6H2,1-2H3/t8?,9-,11?,12-,13-/m1/s1 |
| InChIKey | BXFABBOXDKIRQG-KGNTVIEESA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|