C18H30AcOSi — CID 59976721
(7aS)-7a-methyl-1-[(2S)-5-trimethylsilylpent-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-ol;actinium (PubChem CID 59976721) has the molecular formula C18H30AcOSi and a molecular weight of 517.52 g/mol. Its IUPAC name is (7aS)-7a-methyl-1-[(2S)-5-trimethylsilylpent-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-ol;actinium.
| Compound Name | (7aS)-7a-methyl-1-[(2S)-5-trimethylsilylpent-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-ol;actinium |
|---|---|
| PubChem CID | 59976721 |
| Molecular Formula | C18H30AcOSi |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | (7aS)-7a-methyl-1-[(2S)-5-trimethylsilylpent-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-ol;actinium |
| SMILES | C[C@@H](CC#C[Si](C)(C)C)C1=CCC2C(O)CCC[C@]12C.[Ac] |
| InChI | InChI=1S/C18H30OSi.Ac/c1-14(8-7-13-20(3,4)5)15-10-11-16-17(19)9-6-12-18(15,16)2;/h10,14,16-17,19H,6,8-9,11-12H2,1-5H3;/t14-,16?,17?,18+;/m0./s1 |
| InChIKey | KZDAUDCVBVOVQI-WBTOLASOSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|