C11H20N2OS — CID 59976730
(4S)-7-methyl-4-(methylamino)-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-5-one (PubChem CID 59976730) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is (4S)-7-methyl-4-(methylamino)-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-5-one.
| Compound Name | (4S)-7-methyl-4-(methylamino)-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-5-one |
|---|---|
| PubChem CID | 59976730 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (4S)-7-methyl-4-(methylamino)-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-5-one |
| SMILES | CN[C@H]1CCSC2CCCC(C)N2C1=O |
| InChI | InChI=1S/C11H20N2OS/c1-8-4-3-5-10-13(8)11(14)9(12-2)6-7-15-10/h8-10,12H,3-7H2,1-2H3/t8?,9-,10?/m0/s1 |
| InChIKey | AZWMUPBDSVDFKX-KYHHOPLUSA-N |
| XLogP | 1.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |