C25H38O3 — CID 59976922
(10R,13S,17S)-4,4,10,13-tetramethyl-17-(2-methyl-1,3-dioxolan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 59976922) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (10R,13S,17S)-4,4,10,13-tetramethyl-17-(2-methyl-1,3-dioxolan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S,17S)-4,4,10,13-tetramethyl-17-(2-methyl-1,3-dioxolan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 59976922 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (10R,13S,17S)-4,4,10,13-tetramethyl-17-(2-methyl-1,3-dioxolan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1(C)C(=O)CC[C@@]2(C)C1=CCC1C2CC[C@@]2(C)C1CC[C@@H]2C1(C)OCCO1 |
| InChI | InChI=1S/C25H38O3/c1-22(2)19-8-6-16-17-7-9-20(25(5)27-14-15-28-25)24(17,4)12-10-18(16)23(19,3)13-11-21(22)26/h8,16-18,20H,6-7,9-15H2,1-5H3/t16?,17?,18?,20-,23+,24-/m0/s1 |
| InChIKey | WDCUHMWYABUBIT-FQTRROIASA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|