C19H32O3S — CID 59977195
(Z)-8-[(2Z,4E)-6-hydroxyundeca-2,4-dienyl]sulfanyloct-5-enoic acid (PubChem CID 59977195) has the molecular formula C19H32O3S and a molecular weight of 340.53 g/mol. Its IUPAC name is (Z)-8-[(2Z,4E)-6-hydroxyundeca-2,4-dienyl]sulfanyloct-5-enoic acid.
| Compound Name | (Z)-8-[(2Z,4E)-6-hydroxyundeca-2,4-dienyl]sulfanyloct-5-enoic acid |
|---|---|
| PubChem CID | 59977195 |
| Molecular Formula | C19H32O3S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (Z)-8-[(2Z,4E)-6-hydroxyundeca-2,4-dienyl]sulfanyloct-5-enoic acid |
| SMILES | CCCCCC(O)/C=C/C=C\CSCC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C19H32O3S/c1-2-3-8-13-18(20)14-9-7-12-17-23-16-11-6-4-5-10-15-19(21)22/h4,6-7,9,12,14,18,20H,2-3,5,8,10-11,13,15-17H2,1H3,(H,21,22)/b6-4-,12-7-,14-9+ |
| InChIKey | KGEKQPYKFKGEOG-IZFKJPEVSA-N |
| XLogP | 4.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|